C13H11ClN6O3 — CID 56801333
1-(2-chlorophenyl)-N-(2,4-dioxoimidazolidin-1-yl)-5-methyltriazole-4-carboxamide (PubChem CID 56801333) has the molecular formula C13H11ClN6O3 and a molecular weight of 334.72 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-N-(2,4-dioxoimidazolidin-1-yl)-5-methyltriazole-4-carboxamide.
| Compound Name | 1-(2-chlorophenyl)-N-(2,4-dioxoimidazolidin-1-yl)-5-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 56801333 |
| Molecular Formula | C13H11ClN6O3 |
| Molecular Weight | 334.72 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | 1-(2-chlorophenyl)-N-(2,4-dioxoimidazolidin-1-yl)-5-methyltriazole-4-carboxamide |
| SMILES | Cc1c(C(=O)NN2CC(=O)NC2=O)nnn1-c1ccccc1Cl |
| InChI | InChI=1S/C13H11ClN6O3/c1-7-11(12(22)17-19-6-10(21)15-13(19)23)16-18-20(7)9-5-3-2-4-8(9)14/h2-5H,6H2,1H3,(H,17,22)(H,15,21,23) |
| InChIKey | MVYNHOJRUAIXGB-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 109.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.72 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|