C14H12ClN5O2 — CID 98361607
(2S)-3-[1-(2-chlorophenyl)-5-methyltriazol-4-yl]-2-cyano-N-methyl-3-oxopropanamide (PubChem CID 98361607) has the molecular formula C14H12ClN5O2 and a molecular weight of 317.74 g/mol. Its IUPAC name is (2S)-3-[1-(2-chlorophenyl)-5-methyltriazol-4-yl]-2-cyano-N-methyl-3-oxopropanamide.
| Compound Name | (2S)-3-[1-(2-chlorophenyl)-5-methyltriazol-4-yl]-2-cyano-N-methyl-3-oxopropanamide |
|---|---|
| PubChem CID | 98361607 |
| Molecular Formula | C14H12ClN5O2 |
| Molecular Weight | 317.74 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | (2S)-3-[1-(2-chlorophenyl)-5-methyltriazol-4-yl]-2-cyano-N-methyl-3-oxopropanamide |
| SMILES | CNC(=O)[C@@H](C#N)C(=O)c1nnn(-c2ccccc2Cl)c1C |
| InChI | InChI=1S/C14H12ClN5O2/c1-8-12(13(21)9(7-16)14(22)17-2)18-19-20(8)11-6-4-3-5-10(11)15/h3-6,9H,1-2H3,(H,17,22)/t9-/m0/s1 |
| InChIKey | FJKOEIXUNDYRLL-VIFPVBQESA-N |
| XLogP | 1.30 |
| TPSA | 100.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.74 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|