C13H28N2O3S — CID 56802566
2-[4-[[methyl(3-methylsulfonylpropyl)amino]methyl]piperidin-1-yl]ethanol (PubChem CID 56802566) has the molecular formula C13H28N2O3S and a molecular weight of 292.44 g/mol. Its IUPAC name is 2-[4-[[methyl(3-methylsulfonylpropyl)amino]methyl]piperidin-1-yl]ethanol.
| Compound Name | 2-[4-[[methyl(3-methylsulfonylpropyl)amino]methyl]piperidin-1-yl]ethanol |
|---|---|
| PubChem CID | 56802566 |
| Molecular Formula | C13H28N2O3S |
| Molecular Weight | 292.44 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 2-[4-[[methyl(3-methylsulfonylpropyl)amino]methyl]piperidin-1-yl]ethanol |
| SMILES | CN(CCCS(C)(=O)=O)CC1CCN(CCO)CC1 |
| InChI | InChI=1S/C13H28N2O3S/c1-14(6-3-11-19(2,17)18)12-13-4-7-15(8-5-13)9-10-16/h13,16H,3-12H2,1-2H3 |
| InChIKey | NEDQRKFITICLSH-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.44 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |