C17H35N3O2 — CID 71925951
1-[4-[[methyl(3-morpholin-4-ylpropyl)amino]methyl]piperidin-1-yl]propan-2-ol (PubChem CID 71925951) has the molecular formula C17H35N3O2 and a molecular weight of 313.49 g/mol. Its IUPAC name is 1-[4-[[methyl(3-morpholin-4-ylpropyl)amino]methyl]piperidin-1-yl]propan-2-ol.
| Compound Name | 1-[4-[[methyl(3-morpholin-4-ylpropyl)amino]methyl]piperidin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 71925951 |
| Molecular Formula | C17H35N3O2 |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 313.27 |
| IUPAC Name | 1-[4-[[methyl(3-morpholin-4-ylpropyl)amino]methyl]piperidin-1-yl]propan-2-ol |
| SMILES | CC(O)CN1CCC(CN(C)CCCN2CCOCC2)CC1 |
| InChI | InChI=1S/C17H35N3O2/c1-16(21)14-20-8-4-17(5-9-20)15-18(2)6-3-7-19-10-12-22-13-11-19/h16-17,21H,3-15H2,1-2H3 |
| InChIKey | TXQOFPRDSNQYAF-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 39.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |