C14H27N3O — CID 95339513
4-[[1-[(2S)-2-hydroxypropyl]piperidin-4-yl]methyl-methylamino]butanenitrile (PubChem CID 95339513) has the molecular formula C14H27N3O and a molecular weight of 253.39 g/mol. Its IUPAC name is 4-[[1-[(2S)-2-hydroxypropyl]piperidin-4-yl]methyl-methylamino]butanenitrile.
| Compound Name | 4-[[1-[(2S)-2-hydroxypropyl]piperidin-4-yl]methyl-methylamino]butanenitrile |
|---|---|
| PubChem CID | 95339513 |
| Molecular Formula | C14H27N3O |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.22 |
| IUPAC Name | 4-[[1-[(2S)-2-hydroxypropyl]piperidin-4-yl]methyl-methylamino]butanenitrile |
| SMILES | C[C@H](O)CN1CCC(CN(C)CCCC#N)CC1 |
| InChI | InChI=1S/C14H27N3O/c1-13(18)11-17-9-5-14(6-10-17)12-16(2)8-4-3-7-15/h13-14,18H,3-6,8-12H2,1-2H3/t13-/m0/s1 |
| InChIKey | MOZVPTBGYADIER-ZDUSSCGKSA-N |
| XLogP | 1.31 |
| TPSA | 50.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|