C15H16FN3O5 — CID 56803489
N'-(2-fluoro-4,5-dimethoxyphenyl)-N-[2-oxo-2-(prop-2-ynylamino)ethyl]oxamide (PubChem CID 56803489) has the molecular formula C15H16FN3O5 and a molecular weight of 337.31 g/mol. Its IUPAC name is N'-(2-fluoro-4,5-dimethoxyphenyl)-N-[2-oxo-2-(prop-2-ynylamino)ethyl]oxamide.
| Compound Name | N'-(2-fluoro-4,5-dimethoxyphenyl)-N-[2-oxo-2-(prop-2-ynylamino)ethyl]oxamide |
|---|---|
| PubChem CID | 56803489 |
| Molecular Formula | C15H16FN3O5 |
| Molecular Weight | 337.31 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | N'-(2-fluoro-4,5-dimethoxyphenyl)-N-[2-oxo-2-(prop-2-ynylamino)ethyl]oxamide |
| SMILES | C#CCNC(=O)CNC(=O)C(=O)Nc1cc(OC)c(OC)cc1F |
| InChI | InChI=1S/C15H16FN3O5/c1-4-5-17-13(20)8-18-14(21)15(22)19-10-7-12(24-3)11(23-2)6-9(10)16/h1,6-7H,5,8H2,2-3H3,(H,17,20)(H,18,21)(H,19,22) |
| InChIKey | RBZGLUWAMOJGKA-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.31 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|