About N'-(2-fluoro-4,5-dimethoxyphenyl)-N-[2-oxo-2-(prop-2-ynylamino)ethyl]oxamide
N'-(2-fluoro-4,5-dimethoxyphenyl)-N-[2-oxo-2-(prop-2-ynylamino)ethyl]oxamide (PubChem CID 56803489) has the molecular formula C15H16FN3O5
and a molecular weight of 337.31 g/mol. Its IUPAC name is N'-(2-fluoro-4,5-dimethoxyphenyl)-N-[2-oxo-2-(prop-2-ynylamino)ethyl]oxamide.
Molecular Properties
| Compound Name | N'-(2-fluoro-4,5-dimethoxyphenyl)-N-[2-oxo-2-(prop-2-ynylamino)ethyl]oxamide |
| PubChem CID | 56803489 |
| Molecular Formula | C15H16FN3O5 |
| Molecular Weight | 337.31 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | N'-(2-fluoro-4,5-dimethoxyphenyl)-N-[2-oxo-2-(prop-2-ynylamino)ethyl]oxamide |
| SMILES | C#CCNC(=O)CNC(=O)C(=O)Nc1cc(OC)c(OC)cc1F |
| InChI | InChI=1S/C15H16FN3O5/c1-4-5-17-13(20)8-18-14(21)15(22)19-10-7-12(24-3)11(23-2)6-9(10)16/h1,6-7H,5,8H2,2-3H3,(H,17,20)(H,18,21)(H,19,22) |
| InChIKey | RBZGLUWAMOJGKA-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.31 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-(2-fluoro-4,5-dimethoxyphenyl)-N-[2-oxo-2-(prop-2-ynylamino)ethyl]oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2-fluoro-4,5-dimethoxyphenyl)-N-[2-oxo-2-(prop-2-ynylamino)ethyl]oxamide?
The IUPAC name of N'-(2-fluoro-4,5-dimethoxyphenyl)-N-[2-oxo-2-(prop-2-ynylamino)ethyl]oxamide (CID 56803489) is N'-(2-fluoro-4,5-dimethoxyphenyl)-N-[2-oxo-2-(prop-2-ynylamino)ethyl]oxamide.
What is the SMILES notation for N'-(2-fluoro-4,5-dimethoxyphenyl)-N-[2-oxo-2-(prop-2-ynylamino)ethyl]oxamide?
The canonical SMILES for N'-(2-fluoro-4,5-dimethoxyphenyl)-N-[2-oxo-2-(prop-2-ynylamino)ethyl]oxamide is C#CCNC(=O)CNC(=O)C(=O)Nc1cc(OC)c(OC)cc1F.
What is the InChIKey of N'-(2-fluoro-4,5-dimethoxyphenyl)-N-[2-oxo-2-(prop-2-ynylamino)ethyl]oxamide?
The InChIKey is RBZGLUWAMOJGKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16FN3O5/c1-4-5-17-13(20)8-18-14(21)15(22)19-10-7-12(24-3)11(23-2)6-9(10)16/h1,6-7H,5,8H2,2-3H3,(H,17,20)(H,18,21)(H,19,22).
What are the key properties of N'-(2-fluoro-4,5-dimethoxyphenyl)-N-[2-oxo-2-(prop-2-ynylamino)ethyl]oxamide?
N'-(2-fluoro-4,5-dimethoxyphenyl)-N-[2-oxo-2-(prop-2-ynylamino)ethyl]oxamide has a molecular weight of 337.31 g/mol, XLogP of -0.35, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2-fluoro-4,5-dimethoxyphenyl)-N-[2-oxo-2-(prop-2-ynylamino)ethyl]oxamide is sourced from PubChem (CID 56803489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).