C19H19N3O3 — CID 56806317
[1-(2-cyanoanilino)-1-oxopropan-2-yl] 3-pyridin-3-ylbutanoate (PubChem CID 56806317) has the molecular formula C19H19N3O3 and a molecular weight of 337.38 g/mol. Its IUPAC name is [1-(2-cyanoanilino)-1-oxopropan-2-yl] 3-pyridin-3-ylbutanoate.
| Compound Name | [1-(2-cyanoanilino)-1-oxopropan-2-yl] 3-pyridin-3-ylbutanoate |
|---|---|
| PubChem CID | 56806317 |
| Molecular Formula | C19H19N3O3 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | [1-(2-cyanoanilino)-1-oxopropan-2-yl] 3-pyridin-3-ylbutanoate |
| SMILES | CC(OC(=O)CC(C)c1cccnc1)C(=O)Nc1ccccc1C#N |
| InChI | InChI=1S/C19H19N3O3/c1-13(16-7-5-9-21-12-16)10-18(23)25-14(2)19(24)22-17-8-4-3-6-15(17)11-20/h3-9,12-14H,10H2,1-2H3,(H,22,24) |
| InChIKey | FICFTXLHPHDMNN-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |