C15H18ClNO5 — CID 56806926
(5-methyl-2-oxooxolan-3-yl) 3-(5-chloro-2-methoxyanilino)propanoate (PubChem CID 56806926) has the molecular formula C15H18ClNO5 and a molecular weight of 327.76 g/mol. Its IUPAC name is (5-methyl-2-oxooxolan-3-yl) 3-(5-chloro-2-methoxyanilino)propanoate.
| Compound Name | (5-methyl-2-oxooxolan-3-yl) 3-(5-chloro-2-methoxyanilino)propanoate |
|---|---|
| PubChem CID | 56806926 |
| Molecular Formula | C15H18ClNO5 |
| Molecular Weight | 327.76 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | (5-methyl-2-oxooxolan-3-yl) 3-(5-chloro-2-methoxyanilino)propanoate |
| SMILES | COc1ccc(Cl)cc1NCCC(=O)OC1CC(C)OC1=O |
| InChI | InChI=1S/C15H18ClNO5/c1-9-7-13(15(19)21-9)22-14(18)5-6-17-11-8-10(16)3-4-12(11)20-2/h3-4,8-9,13,17H,5-7H2,1-2H3 |
| InChIKey | NFPNAOVABWFLAX-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.76 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |