C16H23ClN2O4 — CID 56806924
[1-oxo-1-(propan-2-ylamino)propan-2-yl] 3-(5-chloro-2-methoxyanilino)propanoate (PubChem CID 56806924) has the molecular formula C16H23ClN2O4 and a molecular weight of 342.82 g/mol. Its IUPAC name is [1-oxo-1-(propan-2-ylamino)propan-2-yl] 3-(5-chloro-2-methoxyanilino)propanoate.
| Compound Name | [1-oxo-1-(propan-2-ylamino)propan-2-yl] 3-(5-chloro-2-methoxyanilino)propanoate |
|---|---|
| PubChem CID | 56806924 |
| Molecular Formula | C16H23ClN2O4 |
| Molecular Weight | 342.82 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | [1-oxo-1-(propan-2-ylamino)propan-2-yl] 3-(5-chloro-2-methoxyanilino)propanoate |
| SMILES | COc1ccc(Cl)cc1NCCC(=O)OC(C)C(=O)NC(C)C |
| InChI | InChI=1S/C16H23ClN2O4/c1-10(2)19-16(21)11(3)23-15(20)7-8-18-13-9-12(17)5-6-14(13)22-4/h5-6,9-11,18H,7-8H2,1-4H3,(H,19,21) |
| InChIKey | UFPXQXQQVIPMCK-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.82 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |