C20H22ClN3O5 — CID 7805410
[(2R)-1-(5-chloro-2-methoxyanilino)-1-oxopropan-2-yl] 3-(phenylcarbamoylamino)propanoate (PubChem CID 7805410) has the molecular formula C20H22ClN3O5 and a molecular weight of 419.87 g/mol. Its IUPAC name is [(2R)-1-(5-chloro-2-methoxyanilino)-1-oxopropan-2-yl] 3-(phenylcarbamoylamino)propanoate.
| Compound Name | [(2R)-1-(5-chloro-2-methoxyanilino)-1-oxopropan-2-yl] 3-(phenylcarbamoylamino)propanoate |
|---|---|
| PubChem CID | 7805410 |
| Molecular Formula | C20H22ClN3O5 |
| Molecular Weight | 419.87 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | [(2R)-1-(5-chloro-2-methoxyanilino)-1-oxopropan-2-yl] 3-(phenylcarbamoylamino)propanoate |
| SMILES | COc1ccc(Cl)cc1NC(=O)[C@@H](C)OC(=O)CCNC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C20H22ClN3O5/c1-13(19(26)24-16-12-14(21)8-9-17(16)28-2)29-18(25)10-11-22-20(27)23-15-6-4-3-5-7-15/h3-9,12-13H,10-11H2,1-2H3,(H,24,26)(H2,22,23,27)/t13-/m1/s1 |
| InChIKey | IPJSHDLOJSXSSV-CYBMUJFWSA-N |
| XLogP | 3.43 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.87 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |