C15H21NO3 — CID 56806950
[3-(dimethylamino)phenyl]methyl 2-(oxolan-2-yl)acetate (PubChem CID 56806950) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is [3-(dimethylamino)phenyl]methyl 2-(oxolan-2-yl)acetate.
| Compound Name | [3-(dimethylamino)phenyl]methyl 2-(oxolan-2-yl)acetate |
|---|---|
| PubChem CID | 56806950 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | [3-(dimethylamino)phenyl]methyl 2-(oxolan-2-yl)acetate |
| SMILES | CN(C)c1cccc(COC(=O)CC2CCCO2)c1 |
| InChI | InChI=1S/C15H21NO3/c1-16(2)13-6-3-5-12(9-13)11-19-15(17)10-14-7-4-8-18-14/h3,5-6,9,14H,4,7-8,10-11H2,1-2H3 |
| InChIKey | OCHINNCZTQYASQ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |