C11H11NO4S — CID 56806995
(2-methylphenyl) 1,2-oxazol-3-ylmethanesulfonate (PubChem CID 56806995) has the molecular formula C11H11NO4S and a molecular weight of 253.28 g/mol. Its IUPAC name is (2-methylphenyl) 1,2-oxazol-3-ylmethanesulfonate.
| Compound Name | (2-methylphenyl) 1,2-oxazol-3-ylmethanesulfonate |
|---|---|
| PubChem CID | 56806995 |
| Molecular Formula | C11H11NO4S |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.04 |
| IUPAC Name | (2-methylphenyl) 1,2-oxazol-3-ylmethanesulfonate |
| SMILES | Cc1ccccc1OS(=O)(=O)Cc1ccon1 |
| InChI | InChI=1S/C11H11NO4S/c1-9-4-2-3-5-11(9)16-17(13,14)8-10-6-7-15-12-10/h2-7H,8H2,1H3 |
| InChIKey | HBUKBAGFXVRNEF-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|