C12H15N5O5 — CID 56807611
8-[2-(2,5-dioxoimidazolidin-4-yl)acetyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 56807611) has the molecular formula C12H15N5O5 and a molecular weight of 309.28 g/mol. Its IUPAC name is 8-[2-(2,5-dioxoimidazolidin-4-yl)acetyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-[2-(2,5-dioxoimidazolidin-4-yl)acetyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 56807611 |
| Molecular Formula | C12H15N5O5 |
| Molecular Weight | 309.28 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 8-[2-(2,5-dioxoimidazolidin-4-yl)acetyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | O=C1NC(=O)C(CC(=O)N2CCC3(CC2)NC(=O)NC3=O)N1 |
| InChI | InChI=1S/C12H15N5O5/c18-7(5-6-8(19)14-10(21)13-6)17-3-1-12(2-4-17)9(20)15-11(22)16-12/h6H,1-5H2,(H2,13,14,19,21)(H2,15,16,20,22) |
| InChIKey | DYQIRMNPUFZKQT-UHFFFAOYSA-N |
| XLogP | -2.21 |
| TPSA | 136.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.28 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|