C11H18N4O3 — CID 54873031
8-(4-aminobutanoyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 54873031) has the molecular formula C11H18N4O3 and a molecular weight of 254.29 g/mol. Its IUPAC name is 8-(4-aminobutanoyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-(4-aminobutanoyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 54873031 |
| Molecular Formula | C11H18N4O3 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | 8-(4-aminobutanoyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | NCCCC(=O)N1CCC2(CC1)NC(=O)NC2=O |
| InChI | InChI=1S/C11H18N4O3/c12-5-1-2-8(16)15-6-3-11(4-7-15)9(17)13-10(18)14-11/h1-7,12H2,(H2,13,14,17,18) |
| InChIKey | PPONWAHPWSPTDH-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|