C17H20FN3O4 — CID 56807566
8-[4-(4-fluorophenoxy)butanoyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 56807566) has the molecular formula C17H20FN3O4 and a molecular weight of 349.36 g/mol. Its IUPAC name is 8-[4-(4-fluorophenoxy)butanoyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-[4-(4-fluorophenoxy)butanoyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 56807566 |
| Molecular Formula | C17H20FN3O4 |
| Molecular Weight | 349.36 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 8-[4-(4-fluorophenoxy)butanoyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | O=C1NC(=O)C2(CCN(C(=O)CCCOc3ccc(F)cc3)CC2)N1 |
| InChI | InChI=1S/C17H20FN3O4/c18-12-3-5-13(6-4-12)25-11-1-2-14(22)21-9-7-17(8-10-21)15(23)19-16(24)20-17/h3-6H,1-2,7-11H2,(H2,19,20,23,24) |
| InChIKey | RSJDBTKWRGENIY-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.36 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|