C16H15Cl2NO2S — CID 56808108
2-[(2,6-dichlorophenyl)methylsulfinyl]-N-methyl-N-phenylacetamide (PubChem CID 56808108) has the molecular formula C16H15Cl2NO2S and a molecular weight of 356.27 g/mol. Its IUPAC name is 2-[(2,6-dichlorophenyl)methylsulfinyl]-N-methyl-N-phenylacetamide.
| Compound Name | 2-[(2,6-dichlorophenyl)methylsulfinyl]-N-methyl-N-phenylacetamide |
|---|---|
| PubChem CID | 56808108 |
| Molecular Formula | C16H15Cl2NO2S |
| Molecular Weight | 356.27 g/mol |
| Exact Mass | 355.02 |
| IUPAC Name | 2-[(2,6-dichlorophenyl)methylsulfinyl]-N-methyl-N-phenylacetamide |
| SMILES | CN(C(=O)CS(=O)Cc1c(Cl)cccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C16H15Cl2NO2S/c1-19(12-6-3-2-4-7-12)16(20)11-22(21)10-13-14(17)8-5-9-15(13)18/h2-9H,10-11H2,1H3 |
| InChIKey | GYPCMLSCOUWYHB-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.27 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |