C19H18N2O2S2 — CID 56808130
N-phenyl-2-[(2-phenyl-1,3-thiazol-4-yl)methylsulfinyl]propanamide (PubChem CID 56808130) has the molecular formula C19H18N2O2S2 and a molecular weight of 370.50 g/mol. Its IUPAC name is N-phenyl-2-[(2-phenyl-1,3-thiazol-4-yl)methylsulfinyl]propanamide.
| Compound Name | N-phenyl-2-[(2-phenyl-1,3-thiazol-4-yl)methylsulfinyl]propanamide |
|---|---|
| PubChem CID | 56808130 |
| Molecular Formula | C19H18N2O2S2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | N-phenyl-2-[(2-phenyl-1,3-thiazol-4-yl)methylsulfinyl]propanamide |
| SMILES | CC(C(=O)Nc1ccccc1)S(=O)Cc1csc(-c2ccccc2)n1 |
| InChI | InChI=1S/C19H18N2O2S2/c1-14(18(22)20-16-10-6-3-7-11-16)25(23)13-17-12-24-19(21-17)15-8-4-2-5-9-15/h2-12,14H,13H2,1H3,(H,20,22) |
| InChIKey | XFBHGVJKQAIWNP-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |