C24H32N4O2 — CID 56808571
N-[4-[[3-methyl-2-(4-methylpiperidin-1-yl)butyl]carbamoyl]phenyl]pyridine-4-carboxamide (PubChem CID 56808571) has the molecular formula C24H32N4O2 and a molecular weight of 408.55 g/mol. Its IUPAC name is N-[4-[[3-methyl-2-(4-methylpiperidin-1-yl)butyl]carbamoyl]phenyl]pyridine-4-carboxamide.
| Compound Name | N-[4-[[3-methyl-2-(4-methylpiperidin-1-yl)butyl]carbamoyl]phenyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 56808571 |
| Molecular Formula | C24H32N4O2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | N-[4-[[3-methyl-2-(4-methylpiperidin-1-yl)butyl]carbamoyl]phenyl]pyridine-4-carboxamide |
| SMILES | CC1CCN(C(CNC(=O)c2ccc(NC(=O)c3ccncc3)cc2)C(C)C)CC1 |
| InChI | InChI=1S/C24H32N4O2/c1-17(2)22(28-14-10-18(3)11-15-28)16-26-23(29)19-4-6-21(7-5-19)27-24(30)20-8-12-25-13-9-20/h4-9,12-13,17-18,22H,10-11,14-16H2,1-3H3,(H,26,29)(H,27,30) |
| InChIKey | OWRDYJJNXPBPIR-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |