C12H25N3O4S — CID 56808895
2-[butyl-(2,6-dimethylmorpholin-4-yl)sulfonylamino]acetamide (PubChem CID 56808895) has the molecular formula C12H25N3O4S and a molecular weight of 307.42 g/mol. Its IUPAC name is 2-[butyl-(2,6-dimethylmorpholin-4-yl)sulfonylamino]acetamide.
| Compound Name | 2-[butyl-(2,6-dimethylmorpholin-4-yl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 56808895 |
| Molecular Formula | C12H25N3O4S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 2-[butyl-(2,6-dimethylmorpholin-4-yl)sulfonylamino]acetamide |
| SMILES | CCCCN(CC(N)=O)S(=O)(=O)N1CC(C)OC(C)C1 |
| InChI | InChI=1S/C12H25N3O4S/c1-4-5-6-14(9-12(13)16)20(17,18)15-7-10(2)19-11(3)8-15/h10-11H,4-9H2,1-3H3,(H2,13,16) |
| InChIKey | GBJIYVMGGAXLGE-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |