C17H24N4O2S — CID 56812990
1-[4-[2-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-2-oxoethyl]-1,3-thiazol-2-yl]imidazolidin-2-one (PubChem CID 56812990) has the molecular formula C17H24N4O2S and a molecular weight of 348.47 g/mol. Its IUPAC name is 1-[4-[2-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-2-oxoethyl]-1,3-thiazol-2-yl]imidazolidin-2-one.
| Compound Name | 1-[4-[2-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-2-oxoethyl]-1,3-thiazol-2-yl]imidazolidin-2-one |
|---|---|
| PubChem CID | 56812990 |
| Molecular Formula | C17H24N4O2S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 1-[4-[2-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-2-oxoethyl]-1,3-thiazol-2-yl]imidazolidin-2-one |
| SMILES | O=C(Cc1csc(N2CCNC2=O)n1)N1CCC2CCCCC2C1 |
| InChI | InChI=1S/C17H24N4O2S/c22-15(20-7-5-12-3-1-2-4-13(12)10-20)9-14-11-24-17(19-14)21-8-6-18-16(21)23/h11-13H,1-10H2,(H,18,23) |
| InChIKey | WZTHBNALLYNOPS-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |