C18H22N4OS — CID 94519611
1-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-(2-pyrimidin-2-yl-1,3-thiazol-4-yl)ethanone (PubChem CID 94519611) has the molecular formula C18H22N4OS and a molecular weight of 342.47 g/mol. Its IUPAC name is 1-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-(2-pyrimidin-2-yl-1,3-thiazol-4-yl)ethanone.
| Compound Name | 1-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-(2-pyrimidin-2-yl-1,3-thiazol-4-yl)ethanone |
|---|---|
| PubChem CID | 94519611 |
| Molecular Formula | C18H22N4OS |
| Molecular Weight | 342.47 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 1-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-(2-pyrimidin-2-yl-1,3-thiazol-4-yl)ethanone |
| SMILES | O=C(Cc1csc(-c2ncccn2)n1)N1CC[C@@H]2CCCC[C@H]2C1 |
| InChI | InChI=1S/C18H22N4OS/c23-16(22-9-6-13-4-1-2-5-14(13)11-22)10-15-12-24-18(21-15)17-19-7-3-8-20-17/h3,7-8,12-14H,1-2,4-6,9-11H2/t13-,14-/m0/s1 |
| InChIKey | ZGMCXDIMSOLYIQ-KBPBESRZSA-N |
| XLogP | 3.18 |
| TPSA | 58.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.47 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |