About 1-[4-(5-aminotetrazol-1-yl)piperidin-1-yl]-2-(2-pyrimidin-2-yl-1,3-thiazol-4-yl)ethanone
1-[4-(5-aminotetrazol-1-yl)piperidin-1-yl]-2-(2-pyrimidin-2-yl-1,3-thiazol-4-yl)ethanone (PubChem CID 166335855) has the molecular formula C15H17N9OS
and a molecular weight of 371.43 g/mol. Its IUPAC name is 1-[4-(5-aminotetrazol-1-yl)piperidin-1-yl]-2-(2-pyrimidin-2-yl-1,3-thiazol-4-yl)ethanone.
Molecular Properties
| Compound Name | 1-[4-(5-aminotetrazol-1-yl)piperidin-1-yl]-2-(2-pyrimidin-2-yl-1,3-thiazol-4-yl)ethanone |
| PubChem CID | 166335855 |
| Molecular Formula | C15H17N9OS |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | 1-[4-(5-aminotetrazol-1-yl)piperidin-1-yl]-2-(2-pyrimidin-2-yl-1,3-thiazol-4-yl)ethanone |
| SMILES | Nc1nnnn1C1CCN(C(=O)Cc2csc(-c3ncccn3)n2)CC1 |
| InChI | InChI=1S/C15H17N9OS/c16-15-20-21-22-24(15)11-2-6-23(7-3-11)12(25)8-10-9-26-14(19-10)13-17-4-1-5-18-13/h1,4-5,9,11H,2-3,6-8H2,(H2,16,20,22) |
| InChIKey | XEECLHZWTFNSSL-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 128.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Analyze 1-[4-(5-aminotetrazol-1-yl)piperidin-1-yl]-2-(2-pyrimidin-2-yl-1,3-thiazol-4-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(5-aminotetrazol-1-yl)piperidin-1-yl]-2-(2-pyrimidin-2-yl-1,3-thiazol-4-yl)ethanone?
The IUPAC name of 1-[4-(5-aminotetrazol-1-yl)piperidin-1-yl]-2-(2-pyrimidin-2-yl-1,3-thiazol-4-yl)ethanone (CID 166335855) is 1-[4-(5-aminotetrazol-1-yl)piperidin-1-yl]-2-(2-pyrimidin-2-yl-1,3-thiazol-4-yl)ethanone.
What is the SMILES notation for 1-[4-(5-aminotetrazol-1-yl)piperidin-1-yl]-2-(2-pyrimidin-2-yl-1,3-thiazol-4-yl)ethanone?
The canonical SMILES for 1-[4-(5-aminotetrazol-1-yl)piperidin-1-yl]-2-(2-pyrimidin-2-yl-1,3-thiazol-4-yl)ethanone is Nc1nnnn1C1CCN(C(=O)Cc2csc(-c3ncccn3)n2)CC1.
What is the InChIKey of 1-[4-(5-aminotetrazol-1-yl)piperidin-1-yl]-2-(2-pyrimidin-2-yl-1,3-thiazol-4-yl)ethanone?
The InChIKey is XEECLHZWTFNSSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N9OS/c16-15-20-21-22-24(15)11-2-6-23(7-3-11)12(25)8-10-9-26-14(19-10)13-17-4-1-5-18-13/h1,4-5,9,11H,2-3,6-8H2,(H2,16,20,22).
What are the key properties of 1-[4-(5-aminotetrazol-1-yl)piperidin-1-yl]-2-(2-pyrimidin-2-yl-1,3-thiazol-4-yl)ethanone?
1-[4-(5-aminotetrazol-1-yl)piperidin-1-yl]-2-(2-pyrimidin-2-yl-1,3-thiazol-4-yl)ethanone has a molecular weight of 371.43 g/mol, XLogP of 0.57, 4 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(5-aminotetrazol-1-yl)piperidin-1-yl]-2-(2-pyrimidin-2-yl-1,3-thiazol-4-yl)ethanone is sourced from PubChem (CID 166335855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).