C17H19BrN2OS2 — CID 96529648
1-[(3aR,7aS)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-[2-(4-bromothiophen-2-yl)-1,3-thiazol-4-yl]ethanone (PubChem CID 96529648) has the molecular formula C17H19BrN2OS2 and a molecular weight of 411.39 g/mol. Its IUPAC name is 1-[(3aR,7aS)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-[2-(4-bromothiophen-2-yl)-1,3-thiazol-4-yl]ethanone.
| Compound Name | 1-[(3aR,7aS)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-[2-(4-bromothiophen-2-yl)-1,3-thiazol-4-yl]ethanone |
|---|---|
| PubChem CID | 96529648 |
| Molecular Formula | C17H19BrN2OS2 |
| Molecular Weight | 411.39 g/mol |
| Exact Mass | 410.01 |
| IUPAC Name | 1-[(3aR,7aS)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-[2-(4-bromothiophen-2-yl)-1,3-thiazol-4-yl]ethanone |
| SMILES | O=C(Cc1csc(-c2cc(Br)cs2)n1)N1C[C@H]2CCCC[C@H]2C1 |
| InChI | InChI=1S/C17H19BrN2OS2/c18-13-5-15(22-9-13)17-19-14(10-23-17)6-16(21)20-7-11-3-1-2-4-12(11)8-20/h5,9-12H,1-4,6-8H2/t11-,12+ |
| InChIKey | NWIPXBSKUDTBFN-TXEJJXNPSA-N |
| XLogP | 4.83 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.39 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |