C17H27N3O2 — CID 56814568
2-[methyl-[2-[1-[4-(2-methylpropyl)phenyl]ethylamino]-2-oxoethyl]amino]acetamide (PubChem CID 56814568) has the molecular formula C17H27N3O2 and a molecular weight of 305.42 g/mol. Its IUPAC name is 2-[methyl-[2-[1-[4-(2-methylpropyl)phenyl]ethylamino]-2-oxoethyl]amino]acetamide.
| Compound Name | 2-[methyl-[2-[1-[4-(2-methylpropyl)phenyl]ethylamino]-2-oxoethyl]amino]acetamide |
|---|---|
| PubChem CID | 56814568 |
| Molecular Formula | C17H27N3O2 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | 2-[methyl-[2-[1-[4-(2-methylpropyl)phenyl]ethylamino]-2-oxoethyl]amino]acetamide |
| SMILES | CC(C)Cc1ccc(C(C)NC(=O)CN(C)CC(N)=O)cc1 |
| InChI | InChI=1S/C17H27N3O2/c1-12(2)9-14-5-7-15(8-6-14)13(3)19-17(22)11-20(4)10-16(18)21/h5-8,12-13H,9-11H2,1-4H3,(H2,18,21)(H,19,22) |
| InChIKey | ZRGPUGCISYHYNT-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |