C16H25N3O2 — CID 60848149
2-amino-N-[1-[4-(2-methylpropyl)phenyl]ethyl]butanediamide (PubChem CID 60848149) has the molecular formula C16H25N3O2 and a molecular weight of 291.40 g/mol. Its IUPAC name is 2-amino-N-[1-[4-(2-methylpropyl)phenyl]ethyl]butanediamide.
| Compound Name | 2-amino-N-[1-[4-(2-methylpropyl)phenyl]ethyl]butanediamide |
|---|---|
| PubChem CID | 60848149 |
| Molecular Formula | C16H25N3O2 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | 2-amino-N-[1-[4-(2-methylpropyl)phenyl]ethyl]butanediamide |
| SMILES | CC(C)Cc1ccc(C(C)NC(=O)C(N)CC(N)=O)cc1 |
| InChI | InChI=1S/C16H25N3O2/c1-10(2)8-12-4-6-13(7-5-12)11(3)19-16(21)14(17)9-15(18)20/h4-7,10-11,14H,8-9,17H2,1-3H3,(H2,18,20)(H,19,21) |
| InChIKey | SCEADPQBOVFUFE-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |