C20H25N3O2 — CID 56817963
2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl-(1-benzyl-5-methylpyrazol-4-yl)methanone (PubChem CID 56817963) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is 2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl-(1-benzyl-5-methylpyrazol-4-yl)methanone.
| Compound Name | 2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl-(1-benzyl-5-methylpyrazol-4-yl)methanone |
|---|---|
| PubChem CID | 56817963 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | 2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl-(1-benzyl-5-methylpyrazol-4-yl)methanone |
| SMILES | Cc1c(C(=O)N2CCOC3CCCCC32)cnn1Cc1ccccc1 |
| InChI | InChI=1S/C20H25N3O2/c1-15-17(13-21-23(15)14-16-7-3-2-4-8-16)20(24)22-11-12-25-19-10-6-5-9-18(19)22/h2-4,7-8,13,18-19H,5-6,9-12,14H2,1H3 |
| InChIKey | NCJLHOGVPYQXHD-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |