C17H23NO4S — CID 52655582
[(4aR,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-(2-ethylsulfonylphenyl)methanone (PubChem CID 52655582) has the molecular formula C17H23NO4S and a molecular weight of 337.44 g/mol. Its IUPAC name is [(4aR,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-(2-ethylsulfonylphenyl)methanone.
| Compound Name | [(4aR,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-(2-ethylsulfonylphenyl)methanone |
|---|---|
| PubChem CID | 52655582 |
| Molecular Formula | C17H23NO4S |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | [(4aR,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-(2-ethylsulfonylphenyl)methanone |
| SMILES | CCS(=O)(=O)c1ccccc1C(=O)N1CCO[C@@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C17H23NO4S/c1-2-23(20,21)16-10-6-3-7-13(16)17(19)18-11-12-22-15-9-5-4-8-14(15)18/h3,6-7,10,14-15H,2,4-5,8-9,11-12H2,1H3/t14-,15-/m1/s1 |
| InChIKey | AZVCQGOWJUZCRK-HUUCEWRRSA-N |
| XLogP | 2.26 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |