C15H21NO4S — CID 43421223
(2-ethylsulfonylphenyl)-[2-(hydroxymethyl)piperidin-1-yl]methanone (PubChem CID 43421223) has the molecular formula C15H21NO4S and a molecular weight of 311.40 g/mol. Its IUPAC name is (2-ethylsulfonylphenyl)-[2-(hydroxymethyl)piperidin-1-yl]methanone.
| Compound Name | (2-ethylsulfonylphenyl)-[2-(hydroxymethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 43421223 |
| Molecular Formula | C15H21NO4S |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | (2-ethylsulfonylphenyl)-[2-(hydroxymethyl)piperidin-1-yl]methanone |
| SMILES | CCS(=O)(=O)c1ccccc1C(=O)N1CCCCC1CO |
| InChI | InChI=1S/C15H21NO4S/c1-2-21(19,20)14-9-4-3-8-13(14)15(18)16-10-6-5-7-12(16)11-17/h3-4,8-9,12,17H,2,5-7,10-11H2,1H3 |
| InChIKey | ASPBJMPHKLXCOL-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |