C14H12N2O2 — CID 56820803
3-methyl-5-(quinolin-6-yloxymethyl)-1,2-oxazole (PubChem CID 56820803) has the molecular formula C14H12N2O2 and a molecular weight of 240.26 g/mol. Its IUPAC name is 3-methyl-5-(quinolin-6-yloxymethyl)-1,2-oxazole.
| Compound Name | 3-methyl-5-(quinolin-6-yloxymethyl)-1,2-oxazole |
|---|---|
| PubChem CID | 56820803 |
| Molecular Formula | C14H12N2O2 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 3-methyl-5-(quinolin-6-yloxymethyl)-1,2-oxazole |
| SMILES | Cc1cc(COc2ccc3ncccc3c2)on1 |
| InChI | InChI=1S/C14H12N2O2/c1-10-7-13(18-16-10)9-17-12-4-5-14-11(8-12)3-2-6-15-14/h2-8H,9H2,1H3 |
| InChIKey | MNGXUHRCGZHKKL-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |