C12H9N2O3Y- — CID 58784314
6-[(3-methyl-1,2-oxazol-5-yl)methoxy]-2H-1,3-benzoxazol-2-ide;yttrium (PubChem CID 58784314) has the molecular formula C12H9N2O3Y- and a molecular weight of 318.12 g/mol. Its IUPAC name is 6-[(3-methyl-1,2-oxazol-5-yl)methoxy]-2H-1,3-benzoxazol-2-ide;yttrium.
| Compound Name | 6-[(3-methyl-1,2-oxazol-5-yl)methoxy]-2H-1,3-benzoxazol-2-ide;yttrium |
|---|---|
| PubChem CID | 58784314 |
| Molecular Formula | C12H9N2O3Y- |
| Molecular Weight | 318.12 g/mol |
| Exact Mass | 317.97 |
| IUPAC Name | 6-[(3-methyl-1,2-oxazol-5-yl)methoxy]-2H-1,3-benzoxazol-2-ide;yttrium |
| SMILES | Cc1cc(COc2ccc3n[c-]oc3c2)on1.[Y] |
| InChI | InChI=1S/C12H9N2O3.Y/c1-8-4-10(17-14-8)6-15-9-2-3-11-12(5-9)16-7-13-11;/h2-5H,6H2,1H3;/q-1; |
| InChIKey | XRAJHUFQHCXNSF-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 61.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.12 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|