C15H15F3N6 — CID 56821476
6-[4-[[3-(trifluoromethyl)pyrazol-1-yl]methyl]piperazin-1-yl]pyridine-3-carbonitrile (PubChem CID 56821476) has the molecular formula C15H15F3N6 and a molecular weight of 336.32 g/mol. Its IUPAC name is 6-[4-[[3-(trifluoromethyl)pyrazol-1-yl]methyl]piperazin-1-yl]pyridine-3-carbonitrile.
| Compound Name | 6-[4-[[3-(trifluoromethyl)pyrazol-1-yl]methyl]piperazin-1-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 56821476 |
| Molecular Formula | C15H15F3N6 |
| Molecular Weight | 336.32 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 6-[4-[[3-(trifluoromethyl)pyrazol-1-yl]methyl]piperazin-1-yl]pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(N2CCN(Cn3ccc(C(F)(F)F)n3)CC2)nc1 |
| InChI | InChI=1S/C15H15F3N6/c16-15(17,18)13-3-4-24(21-13)11-22-5-7-23(8-6-22)14-2-1-12(9-19)10-20-14/h1-4,10H,5-8,11H2 |
| InChIKey | SCOKXGCRGNESTM-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 60.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.32 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |