C20H26N2O3 — CID 56823449
2-methoxy-5-[[[1-(3-methoxyphenyl)pyrrolidin-3-yl]methylamino]methyl]phenol (PubChem CID 56823449) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is 2-methoxy-5-[[[1-(3-methoxyphenyl)pyrrolidin-3-yl]methylamino]methyl]phenol.
| Compound Name | 2-methoxy-5-[[[1-(3-methoxyphenyl)pyrrolidin-3-yl]methylamino]methyl]phenol |
|---|---|
| PubChem CID | 56823449 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 2-methoxy-5-[[[1-(3-methoxyphenyl)pyrrolidin-3-yl]methylamino]methyl]phenol |
| SMILES | COc1cccc(N2CCC(CNCc3ccc(OC)c(O)c3)C2)c1 |
| InChI | InChI=1S/C20H26N2O3/c1-24-18-5-3-4-17(11-18)22-9-8-16(14-22)13-21-12-15-6-7-20(25-2)19(23)10-15/h3-7,10-11,16,21,23H,8-9,12-14H2,1-2H3 |
| InChIKey | ABAPACDGWJQFRC-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |