C18H20F3N3 — CID 56824519
1-(6-piperidin-1-yl-3-pyridinyl)-N-[(3,4,5-trifluorophenyl)methyl]methanamine (PubChem CID 56824519) has the molecular formula C18H20F3N3 and a molecular weight of 335.37 g/mol. Its IUPAC name is 1-(6-piperidin-1-yl-3-pyridinyl)-N-[(3,4,5-trifluorophenyl)methyl]methanamine.
| Compound Name | 1-(6-piperidin-1-yl-3-pyridinyl)-N-[(3,4,5-trifluorophenyl)methyl]methanamine |
|---|---|
| PubChem CID | 56824519 |
| Molecular Formula | C18H20F3N3 |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 1-(6-piperidin-1-yl-3-pyridinyl)-N-[(3,4,5-trifluorophenyl)methyl]methanamine |
| SMILES | Fc1cc(CNCc2ccc(N3CCCCC3)nc2)cc(F)c1F |
| InChI | InChI=1S/C18H20F3N3/c19-15-8-14(9-16(20)18(15)21)11-22-10-13-4-5-17(23-12-13)24-6-2-1-3-7-24/h4-5,8-9,12,22H,1-3,6-7,10-11H2 |
| InChIKey | IQOIASALUIPKQV-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|