C22H38O7 — CID 568262
[6-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl] decanoate (PubChem CID 568262) has the molecular formula C22H38O7 and a molecular weight of 414.54 g/mol. Its IUPAC name is [6-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl] decanoate.
| Compound Name | [6-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl] decanoate |
|---|---|
| PubChem CID | 568262 |
| Molecular Formula | C22H38O7 |
| Molecular Weight | 414.54 g/mol |
| Exact Mass | 414.26 |
| IUPAC Name | [6-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl] decanoate |
| SMILES | CCCCCCCCCC(=O)OC1OC(C2COC(C)(C)O2)C2OC(C)(C)OC12 |
| InChI | InChI=1S/C22H38O7/c1-6-7-8-9-10-11-12-13-16(23)25-20-19-18(28-22(4,5)29-19)17(26-20)15-14-24-21(2,3)27-15/h15,17-20H,6-14H2,1-5H3 |
| InChIKey | XHVJTYJBBLTYIB-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.54 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|