C14H13Cl2NO — CID 56830677
3-(2,4-dichloronaphthalen-1-yl)oxypyrrolidine (PubChem CID 56830677) has the molecular formula C14H13Cl2NO and a molecular weight of 282.17 g/mol. Its IUPAC name is 3-(2,4-dichloronaphthalen-1-yl)oxypyrrolidine.
| Compound Name | 3-(2,4-dichloronaphthalen-1-yl)oxypyrrolidine |
|---|---|
| PubChem CID | 56830677 |
| Molecular Formula | C14H13Cl2NO |
| Molecular Weight | 282.17 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | 3-(2,4-dichloronaphthalen-1-yl)oxypyrrolidine |
| SMILES | Clc1cc(Cl)c2ccccc2c1OC1CCNC1 |
| InChI | InChI=1S/C14H13Cl2NO/c15-12-7-13(16)14(18-9-5-6-17-8-9)11-4-2-1-3-10(11)12/h1-4,7,9,17H,5-6,8H2 |
| InChIKey | FXIDKJYZEJWDCH-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.17 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |