C13H18ClF2NO — CID 56831222
3-[(2,4-difluorophenyl)methoxymethyl]piperidine;hydrochloride (PubChem CID 56831222) has the molecular formula C13H18ClF2NO and a molecular weight of 277.74 g/mol. Its IUPAC name is 3-[(2,4-difluorophenyl)methoxymethyl]piperidine;hydrochloride.
| Compound Name | 3-[(2,4-difluorophenyl)methoxymethyl]piperidine;hydrochloride |
|---|---|
| PubChem CID | 56831222 |
| Molecular Formula | C13H18ClF2NO |
| Molecular Weight | 277.74 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 3-[(2,4-difluorophenyl)methoxymethyl]piperidine;hydrochloride |
| SMILES | Cl.Fc1ccc(COCC2CCCNC2)c(F)c1 |
| InChI | InChI=1S/C13H17F2NO.ClH/c14-12-4-3-11(13(15)6-12)9-17-8-10-2-1-5-16-7-10;/h3-4,6,10,16H,1-2,5,7-9H2;1H |
| InChIKey | XJWCFAJOHAZNPC-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.74 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |