C15H21ClN3O4PS — CID 56833948
4-[2-chloro-6-(diethoxyphosphorylmethyl)thieno[2,3-d]pyrimidin-4-yl]morpholine (PubChem CID 56833948) has the molecular formula C15H21ClN3O4PS and a molecular weight of 405.84 g/mol. Its IUPAC name is 4-[2-chloro-6-(diethoxyphosphorylmethyl)thieno[2,3-d]pyrimidin-4-yl]morpholine.
| Compound Name | 4-[2-chloro-6-(diethoxyphosphorylmethyl)thieno[2,3-d]pyrimidin-4-yl]morpholine |
|---|---|
| PubChem CID | 56833948 |
| Molecular Formula | C15H21ClN3O4PS |
| Molecular Weight | 405.84 g/mol |
| Exact Mass | 405.07 |
| IUPAC Name | 4-[2-chloro-6-(diethoxyphosphorylmethyl)thieno[2,3-d]pyrimidin-4-yl]morpholine |
| SMILES | CCOP(=O)(Cc1cc2c(N3CCOCC3)nc(Cl)nc2s1)OCC |
| InChI | InChI=1S/C15H21ClN3O4PS/c1-3-22-24(20,23-4-2)10-11-9-12-13(19-5-7-21-8-6-19)17-15(16)18-14(12)25-11/h9H,3-8,10H2,1-2H3 |
| InChIKey | OZBQGRCKVVMVPP-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 73.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.84 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|