C15H12ClFN4OS — CID 86618371
4-[2-chloro-6-(6-fluoro-3-pyridinyl)thieno[2,3-d]pyrimidin-4-yl]morpholine (PubChem CID 86618371) has the molecular formula C15H12ClFN4OS and a molecular weight of 350.81 g/mol. Its IUPAC name is 4-[2-chloro-6-(6-fluoro-3-pyridinyl)thieno[2,3-d]pyrimidin-4-yl]morpholine.
| Compound Name | 4-[2-chloro-6-(6-fluoro-3-pyridinyl)thieno[2,3-d]pyrimidin-4-yl]morpholine |
|---|---|
| PubChem CID | 86618371 |
| Molecular Formula | C15H12ClFN4OS |
| Molecular Weight | 350.81 g/mol |
| Exact Mass | 350.04 |
| IUPAC Name | 4-[2-chloro-6-(6-fluoro-3-pyridinyl)thieno[2,3-d]pyrimidin-4-yl]morpholine |
| SMILES | Fc1ccc(-c2cc3c(N4CCOCC4)nc(Cl)nc3s2)cn1 |
| InChI | InChI=1S/C15H12ClFN4OS/c16-15-19-13(21-3-5-22-6-4-21)10-7-11(23-14(10)20-15)9-1-2-12(17)18-8-9/h1-2,7-8H,3-6H2 |
| InChIKey | XQVCEDHXAWYREU-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.81 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|