C54H46NO2P — CID 56835730
(2-diphenylphosphanylphenyl)methyl-trimethylazanium;1-(2-hydroxy-3-phenylnaphthalen-1-yl)-3-phenylnaphthalen-2-olate (PubChem CID 56835730) has the molecular formula C54H46NO2P and a molecular weight of 771.94 g/mol. Its IUPAC name is (2-diphenylphosphanylphenyl)methyl-trimethylazanium;1-(2-hydroxy-3-phenylnaphthalen-1-yl)-3-phenylnaphthalen-2-olate.
| Compound Name | (2-diphenylphosphanylphenyl)methyl-trimethylazanium;1-(2-hydroxy-3-phenylnaphthalen-1-yl)-3-phenylnaphthalen-2-olate |
|---|---|
| PubChem CID | 56835730 |
| Molecular Formula | C54H46NO2P |
| Molecular Weight | 771.94 g/mol |
| Exact Mass | 771.33 |
| IUPAC Name | (2-diphenylphosphanylphenyl)methyl-trimethylazanium;1-(2-hydroxy-3-phenylnaphthalen-1-yl)-3-phenylnaphthalen-2-olate |
| SMILES | C[N+](C)(C)Cc1ccccc1P(c1ccccc1)c1ccccc1.[O-]c1c(-c2ccccc2)cc2ccccc2c1-c1c(O)c(-c2ccccc2)cc2ccccc12 |
| InChI | InChI=1S/C32H22O2.C22H25NP/c33-31-27(21-11-3-1-4-12-21)19-23-15-7-9-17-25(23)29(31)30-26-18-10-8-16-24(26)20-28(32(30)34)22-13-5-2-6-14-22;1-23(2,3)18-19-12-10-11-17-22(19)24(20-13-6-4-7-14-20)21-15-8-5-9-16-21/h1-20,33-34H;4-17H,18H2,1-3H3/q;+1/p-1 |
| InChIKey | ZUVSDRWXRWHIJS-UHFFFAOYSA-M |
| XLogP | 11.42 |
| TPSA | 43.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.94 |
| LogP ≤ 5 | 11.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|