C32H29BrFN3O2 — CID 56837256
10-(4-bromophenyl)-2-(4-fluorophenyl)-8,8-dimethyl-5-(4-methylphenyl)-1,2,3,5,7,9-hexahydropyrimido[4,5-b]quinoline-4,6-dione (PubChem CID 56837256) has the molecular formula C32H29BrFN3O2 and a molecular weight of 586.51 g/mol. Its IUPAC name is 10-(4-bromophenyl)-2-(4-fluorophenyl)-8,8-dimethyl-5-(4-methylphenyl)-1,2,3,5,7,9-hexahydropyrimido[4,5-b]quinoline-4,6-dione.
| Compound Name | 10-(4-bromophenyl)-2-(4-fluorophenyl)-8,8-dimethyl-5-(4-methylphenyl)-1,2,3,5,7,9-hexahydropyrimido[4,5-b]quinoline-4,6-dione |
|---|---|
| PubChem CID | 56837256 |
| Molecular Formula | C32H29BrFN3O2 |
| Molecular Weight | 586.51 g/mol |
| Exact Mass | 585.14 |
| IUPAC Name | 10-(4-bromophenyl)-2-(4-fluorophenyl)-8,8-dimethyl-5-(4-methylphenyl)-1,2,3,5,7,9-hexahydropyrimido[4,5-b]quinoline-4,6-dione |
| SMILES | Cc1ccc(C2C3=C(CC(C)(C)CC3=O)N(c3ccc(Br)cc3)C3=C2C(=O)NC(c2ccc(F)cc2)N3)cc1 |
| InChI | InChI=1S/C32H29BrFN3O2/c1-18-4-6-19(7-5-18)26-27-24(16-32(2,3)17-25(27)38)37(23-14-10-21(33)11-15-23)30-28(26)31(39)36-29(35-30)20-8-12-22(34)13-9-20/h4-15,26,29,35H,16-17H2,1-3H3,(H,36,39) |
| InChIKey | NNCUWRFITQASAE-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.51 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |