C27H28N2O2 — CID 56837830
[2-methyl-1-(2-morpholin-4-ylethyl)indol-3-yl]-(4-methylnaphthalen-2-yl)methanone (PubChem CID 56837830) has the molecular formula C27H28N2O2 and a molecular weight of 412.53 g/mol. Its IUPAC name is [2-methyl-1-(2-morpholin-4-ylethyl)indol-3-yl]-(4-methylnaphthalen-2-yl)methanone.
| Compound Name | [2-methyl-1-(2-morpholin-4-ylethyl)indol-3-yl]-(4-methylnaphthalen-2-yl)methanone |
|---|---|
| PubChem CID | 56837830 |
| Molecular Formula | C27H28N2O2 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | [2-methyl-1-(2-morpholin-4-ylethyl)indol-3-yl]-(4-methylnaphthalen-2-yl)methanone |
| SMILES | Cc1cc(C(=O)c2c(C)n(CCN3CCOCC3)c3ccccc23)cc2ccccc12 |
| InChI | InChI=1S/C27H28N2O2/c1-19-17-22(18-21-7-3-4-8-23(19)21)27(30)26-20(2)29(25-10-6-5-9-24(25)26)12-11-28-13-15-31-16-14-28/h3-10,17-18H,11-16H2,1-2H3 |
| InChIKey | PMQJOMPDHYADMV-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |