C23H28N2O7S — CID 139640512
[3-(4-methoxybenzoyl)-1-(2-morpholin-4-ylethyl)indol-2-yl]methanesulfonic acid;hydrate (PubChem CID 139640512) has the molecular formula C23H28N2O7S and a molecular weight of 476.55 g/mol. Its IUPAC name is [3-(4-methoxybenzoyl)-1-(2-morpholin-4-ylethyl)indol-2-yl]methanesulfonic acid;hydrate.
| Compound Name | [3-(4-methoxybenzoyl)-1-(2-morpholin-4-ylethyl)indol-2-yl]methanesulfonic acid;hydrate |
|---|---|
| PubChem CID | 139640512 |
| Molecular Formula | C23H28N2O7S |
| Molecular Weight | 476.55 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | [3-(4-methoxybenzoyl)-1-(2-morpholin-4-ylethyl)indol-2-yl]methanesulfonic acid;hydrate |
| SMILES | COc1ccc(C(=O)c2c(CS(=O)(=O)O)n(CCN3CCOCC3)c3ccccc23)cc1.O |
| InChI | InChI=1S/C23H26N2O6S.H2O/c1-30-18-8-6-17(7-9-18)23(26)22-19-4-2-3-5-20(19)25(21(22)16-32(27,28)29)11-10-24-12-14-31-15-13-24;/h2-9H,10-16H2,1H3,(H,27,28,29);1H2 |
| InChIKey | RKKLSVGZAGWKFV-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 129.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.55 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|