C31H35N3O8S — CID 3075311
4-[2-[3-(3,4-dimethoxyphenyl)-2-(4-methoxyphenyl)pyrrolo[1,2-a]benzimidazol-4-yl]ethyl]morpholine;sulfuric acid (PubChem CID 3075311) has the molecular formula C31H35N3O8S and a molecular weight of 609.70 g/mol. Its IUPAC name is 4-[2-[3-(3,4-dimethoxyphenyl)-2-(4-methoxyphenyl)pyrrolo[1,2-a]benzimidazol-4-yl]ethyl]morpholine;sulfuric acid.
| Compound Name | 4-[2-[3-(3,4-dimethoxyphenyl)-2-(4-methoxyphenyl)pyrrolo[1,2-a]benzimidazol-4-yl]ethyl]morpholine;sulfuric acid |
|---|---|
| PubChem CID | 3075311 |
| Molecular Formula | C31H35N3O8S |
| Molecular Weight | 609.70 g/mol |
| Exact Mass | 609.21 |
| IUPAC Name | 4-[2-[3-(3,4-dimethoxyphenyl)-2-(4-methoxyphenyl)pyrrolo[1,2-a]benzimidazol-4-yl]ethyl]morpholine;sulfuric acid |
| SMILES | COc1ccc(-c2cn3c4ccccc4n(CCN4CCOCC4)c3c2-c2ccc(OC)c(OC)c2)cc1.O=S(=O)(O)O |
| InChI | InChI=1S/C31H33N3O4.H2O4S/c1-35-24-11-8-22(9-12-24)25-21-34-27-7-5-4-6-26(27)33(15-14-32-16-18-38-19-17-32)31(34)30(25)23-10-13-28(36-2)29(20-23)37-3;1-5(2,3)4/h4-13,20-21H,14-19H2,1-3H3;(H2,1,2,3,4) |
| InChIKey | VRRRQJAGBHGUBV-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 124.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.70 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|