C23H30N4O6S — CID 67711828
2-[2-(3,4-dimethoxyphenyl)imidazo[1,2-a]benzimidazol-4-yl]-N,N-diethylethanamine;sulfuric acid (PubChem CID 67711828) has the molecular formula C23H30N4O6S and a molecular weight of 490.58 g/mol. Its IUPAC name is 2-[2-(3,4-dimethoxyphenyl)imidazo[1,2-a]benzimidazol-4-yl]-N,N-diethylethanamine;sulfuric acid.
| Compound Name | 2-[2-(3,4-dimethoxyphenyl)imidazo[1,2-a]benzimidazol-4-yl]-N,N-diethylethanamine;sulfuric acid |
|---|---|
| PubChem CID | 67711828 |
| Molecular Formula | C23H30N4O6S |
| Molecular Weight | 490.58 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | 2-[2-(3,4-dimethoxyphenyl)imidazo[1,2-a]benzimidazol-4-yl]-N,N-diethylethanamine;sulfuric acid |
| SMILES | CCN(CC)CCn1c2ccccc2n2cc(-c3ccc(OC)c(OC)c3)nc12.O=S(=O)(O)O |
| InChI | InChI=1S/C23H28N4O2.H2O4S/c1-5-25(6-2)13-14-26-19-9-7-8-10-20(19)27-16-18(24-23(26)27)17-11-12-21(28-3)22(15-17)29-4;1-5(2,3)4/h7-12,15-16H,5-6,13-14H2,1-4H3;(H2,1,2,3,4) |
| InChIKey | KOMPLYCDUHLZNM-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 118.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.58 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|