C15H20N4 — CID 1399988
N,N-diethyl-2-imidazo[1,2-a]benzimidazol-4-ylethanamine (PubChem CID 1399988) has the molecular formula C15H20N4 and a molecular weight of 256.35 g/mol. Its IUPAC name is N,N-diethyl-2-imidazo[1,2-a]benzimidazol-4-ylethanamine.
| Compound Name | N,N-diethyl-2-imidazo[1,2-a]benzimidazol-4-ylethanamine |
|---|---|
| PubChem CID | 1399988 |
| Molecular Formula | C15H20N4 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | N,N-diethyl-2-imidazo[1,2-a]benzimidazol-4-ylethanamine |
| SMILES | CCN(CC)CCn1c2ccccc2n2ccnc12 |
| InChI | InChI=1S/C15H20N4/c1-3-17(4-2)11-12-19-14-8-6-5-7-13(14)18-10-9-16-15(18)19/h5-10H,3-4,11-12H2,1-2H3 |
| InChIKey | DWAZPUJKHVFRGR-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 25.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |