C25H29Cl3N4O3 — CID 1203393
(1S)-2,2,2-trichloro-1-[4-[2-(diethylamino)ethyl]-2-(3,4-dimethoxyphenyl)imidazo[1,2-a]benzimidazol-1-yl]ethanol (PubChem CID 1203393) has the molecular formula C25H29Cl3N4O3 and a molecular weight of 539.89 g/mol. Its IUPAC name is (1S)-2,2,2-trichloro-1-[4-[2-(diethylamino)ethyl]-2-(3,4-dimethoxyphenyl)imidazo[1,2-a]benzimidazol-1-yl]ethanol.
| Compound Name | (1S)-2,2,2-trichloro-1-[4-[2-(diethylamino)ethyl]-2-(3,4-dimethoxyphenyl)imidazo[1,2-a]benzimidazol-1-yl]ethanol |
|---|---|
| PubChem CID | 1203393 |
| Molecular Formula | C25H29Cl3N4O3 |
| Molecular Weight | 539.89 g/mol |
| Exact Mass | 538.13 |
| IUPAC Name | (1S)-2,2,2-trichloro-1-[4-[2-(diethylamino)ethyl]-2-(3,4-dimethoxyphenyl)imidazo[1,2-a]benzimidazol-1-yl]ethanol |
| SMILES | CCN(CC)CCn1c2ccccc2n2c([C@H](O)C(Cl)(Cl)Cl)c(-c3ccc(OC)c(OC)c3)nc12 |
| InChI | InChI=1S/C25H29Cl3N4O3/c1-5-30(6-2)13-14-31-17-9-7-8-10-18(17)32-22(23(33)25(26,27)28)21(29-24(31)32)16-11-12-19(34-3)20(15-16)35-4/h7-12,15,23,33H,5-6,13-14H2,1-4H3/t23-/m0/s1 |
| InChIKey | VEQRKJYLNYYXAJ-QHCPKHFHSA-N |
| XLogP | 5.72 |
| TPSA | 64.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.89 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|