C29H39N6O8PSi — CID 56838084
[(2R,3R,4R,5R)-5-(6-benzamidopurin-9-yl)-4-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)oxolan-3-yl] 2-cyanoethyl prop-2-enyl phosphate (PubChem CID 56838084) has the molecular formula C29H39N6O8PSi and a molecular weight of 658.73 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-(6-benzamidopurin-9-yl)-4-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)oxolan-3-yl] 2-cyanoethyl prop-2-enyl phosphate.
| Compound Name | [(2R,3R,4R,5R)-5-(6-benzamidopurin-9-yl)-4-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)oxolan-3-yl] 2-cyanoethyl prop-2-enyl phosphate |
|---|---|
| PubChem CID | 56838084 |
| Molecular Formula | C29H39N6O8PSi |
| Molecular Weight | 658.73 g/mol |
| Exact Mass | 658.23 |
| IUPAC Name | [(2R,3R,4R,5R)-5-(6-benzamidopurin-9-yl)-4-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)oxolan-3-yl] 2-cyanoethyl prop-2-enyl phosphate |
| SMILES | C=CCOP(=O)(OCCC#N)O[C@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](n2cnc3c(NC(=O)c4ccccc4)ncnc32)O[C@@H]1CO |
| InChI | InChI=1S/C29H39N6O8PSi/c1-7-15-39-44(38,40-16-11-14-30)42-23-21(17-36)41-28(24(23)43-45(5,6)29(2,3)4)35-19-33-22-25(31-18-32-26(22)35)34-27(37)20-12-9-8-10-13-20/h7-10,12-13,18-19,21,23-24,28,36H,1,11,15-17H2,2-6H3,(H,31,32,34,37)/t21-,23-,24-,28-,44?/m1/s1 |
| InChIKey | RDJOMZHKDQSFAD-MUXRPOTISA-N |
| XLogP | 4.98 |
| TPSA | 179.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.73 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|