C17H30O5 — CID 56838095
ethyl (Z)-3-[(4S,5S)-5-[(6S)-6-hydroxyheptyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate (PubChem CID 56838095) has the molecular formula C17H30O5 and a molecular weight of 314.42 g/mol. Its IUPAC name is ethyl (Z)-3-[(4S,5S)-5-[(6S)-6-hydroxyheptyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate.
| Compound Name | ethyl (Z)-3-[(4S,5S)-5-[(6S)-6-hydroxyheptyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 56838095 |
| Molecular Formula | C17H30O5 |
| Molecular Weight | 314.42 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | ethyl (Z)-3-[(4S,5S)-5-[(6S)-6-hydroxyheptyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C\[C@@H]1OC(C)(C)O[C@H]1CCCCC[C@H](C)O |
| InChI | InChI=1S/C17H30O5/c1-5-20-16(19)12-11-15-14(21-17(3,4)22-15)10-8-6-7-9-13(2)18/h11-15,18H,5-10H2,1-4H3/b12-11-/t13-,14-,15-/m0/s1 |
| InChIKey | BGWWSHILHUSCHM-WJIFRPJFSA-N |
| XLogP | 2.96 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.42 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|