C26H24IN3O6S2 — CID 56838605
(3-ethoxycarbonyl-5-methyl-6-oxo-4H-imidazo[1,5-a][1,4]benzodiazepin-8-yl)-thiophen-3-yliodanium;4-methylbenzenesulfonate (PubChem CID 56838605) has the molecular formula C26H24IN3O6S2 and a molecular weight of 665.53 g/mol. Its IUPAC name is (3-ethoxycarbonyl-5-methyl-6-oxo-4H-imidazo[1,5-a][1,4]benzodiazepin-8-yl)-thiophen-3-yliodanium;4-methylbenzenesulfonate.
| Compound Name | (3-ethoxycarbonyl-5-methyl-6-oxo-4H-imidazo[1,5-a][1,4]benzodiazepin-8-yl)-thiophen-3-yliodanium;4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 56838605 |
| Molecular Formula | C26H24IN3O6S2 |
| Molecular Weight | 665.53 g/mol |
| Exact Mass | 665.02 |
| IUPAC Name | (3-ethoxycarbonyl-5-methyl-6-oxo-4H-imidazo[1,5-a][1,4]benzodiazepin-8-yl)-thiophen-3-yliodanium;4-methylbenzenesulfonate |
| SMILES | CCOC(=O)c1ncn2c1CN(C)C(=O)c1cc([I+]c3ccsc3)ccc1-2.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C19H17IN3O3S.C7H8O3S/c1-3-26-19(25)17-16-9-22(2)18(24)14-8-12(20-13-6-7-27-10-13)4-5-15(14)23(16)11-21-17;1-6-2-4-7(5-3-6)11(8,9)10/h4-8,10-11H,3,9H2,1-2H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1 |
| InChIKey | RDZAZPKYZCTWEX-UHFFFAOYSA-M |
| XLogP | 0.72 |
| TPSA | 121.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.53 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|