C14H13ClN4O3 — CID 71521516
ethyl 12-chloro-8-methyl-9-oxo-2,4,8,11-tetrazatricyclo[8.4.0.02,6]tetradeca-1(10),3,5,11,13-pentaene-5-carboxylate (PubChem CID 71521516) has the molecular formula C14H13ClN4O3 and a molecular weight of 320.74 g/mol. Its IUPAC name is ethyl 12-chloro-8-methyl-9-oxo-2,4,8,11-tetrazatricyclo[8.4.0.02,6]tetradeca-1(10),3,5,11,13-pentaene-5-carboxylate.
| Compound Name | ethyl 12-chloro-8-methyl-9-oxo-2,4,8,11-tetrazatricyclo[8.4.0.02,6]tetradeca-1(10),3,5,11,13-pentaene-5-carboxylate |
|---|---|
| PubChem CID | 71521516 |
| Molecular Formula | C14H13ClN4O3 |
| Molecular Weight | 320.74 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | ethyl 12-chloro-8-methyl-9-oxo-2,4,8,11-tetrazatricyclo[8.4.0.02,6]tetradeca-1(10),3,5,11,13-pentaene-5-carboxylate |
| SMILES | CCOC(=O)c1ncn2c1CN(C)C(=O)c1nc(Cl)ccc1-2 |
| InChI | InChI=1S/C14H13ClN4O3/c1-3-22-14(21)12-9-6-18(2)13(20)11-8(19(9)7-16-12)4-5-10(15)17-11/h4-5,7H,3,6H2,1-2H3 |
| InChIKey | KIGIKZUZMZPTKH-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.74 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|